{
"markdown": "BXMT HIGHLIGHTS\n - Q1 GAAP EPS of $(0.04), Distributable EPS(1) of $0.21, and Distributable EPS prior to realized gains and losses(1) of $0.49\n\n\n### Earnings Power \nStrong current income supporting attractive dividend \n\n$0.49 \ndistributable EPS prior to realized gains and losses(1) \n\n$0.47 \ndividend per share, equating to a 9.4% annualized yield(a) \n\nInvestment Activity \nCapturing differentiated \nopportunities across channels \n\n$0.5B \ntotal investments(b) \n\n82 \nnet lease properties acquired \n\n### Credit Performance\nWell-performing loans in high-conviction sectors\n\n98%\nperforming loan portfolio(c)(d)\n\n50%+\nloans secured by residential\nand industrial investments(c)(d)\n\nNote: The information in this presentation is as of March 31, 2026, and all averages are weighted averages, unless otherwise stated. Opinions expressed reflect the current opinions of BXMT as of the date\nindicated only and are based on BXMT's opinions of the current market environment, which is subject to change. Estimates, targets, forecasts, or similar predictions or returns are necessarily speculative,\nhypothetical, and inherently uncertain in nature, and it can be expected that some or all of the assumptions underlying such estimates, targets, forecasts, or similar predictions or returns contained\nherein will not materialize and/or that actual events and consequences thereof will vary materially from the assumptions upon which such estimates, targets, forecasts, or similar predictions or returns\nhave been based. BXMT's manager is a subsidiary of Blackstone.\n(1) See Appendix for definition and reconciliation to GAAP net (loss) income.\n\n\nBlackstone Mortgage Trust, Inc.\n\n\nBlackstone | 1\n\n",
"structure": {
"type": "document",
"markdown": null,
"children": [
{
"type": "page",
"page": null,
"span": null,
"width": null,
"height": null,
"dpi": null,
"grounding": {
"page": 1,
"range": {
"start": 0,
"end": 1758
},
"box": {
"xmin": 0.0,
"ymin": 0.0,
"xmax": 1.0,
"ymax": 1.0
}
},
"markdown": null,
"status": "ok",
"reason": null,
"children": [
{
"type": "text",
"id": "text-0",
"span": null,
"grounding": {
"page": 1,
"range": {
"start": 0,
"end": 165
},
"box": {
"xmin": 0.04221,
"ymin": 0.04164,
"xmax": 0.9723,
"ymax": 0.14907
}
},
"atomic_grounding": [
{
"page": 1,
"range": {
"start": 0,
"end": 16
},
"box": {
"xmin": 0.0461,
"ymin": 0.04551,
"xmax": 0.19547,
"ymax": 0.07483
}
},
{
"page": 1,
"range": {
"start": 16,
"end": 165
},
"box": {
"xmin": 0.04698,
"ymin": 0.10916,
"xmax": 0.97027,
"ymax": 0.14106
}
}
],
"markdown": null,
"children": null,
"row": null,
"col": null,
"colspan": null,
"rowspan": null
},
{
"type": "text",
"id": "text-1",
"span": null,
"grounding": {
"page": 1,
"range": {
"start": 167,
"end": 395
},
"box": {
"xmin": 0.03903,
"ymin": 0.25534,
"xmax": 0.33803,
"ymax": 0.72845
}
},
"atomic_grounding": [
{
"page": 1,
"range": {
"start": 167,
"end": 186
},
"box": {
"xmin": 0.04634,
"ymin": 0.26372,
"xmax": 0.21339,
"ymax": 0.29326
}
},
{
"page": 1,
"range": {
"start": 186,
"end": 240
},
"box": {
"xmin": 0.04652,
"ymin": 0.30212,
"xmax": 0.27846,
"ymax": 0.35451
}
},
{
"page": 1,
"range": {
"start": 240,
"end": 248
},
"box": {
"xmin": 0.06748,
"ymin": 0.41589,
"xmax": 0.17688,
"ymax": 0.47004
}
},
{
"page": 1,
"range": {
"start": 248,
"end": 316
},
"box": {
"xmin": 0.06643,
"ymin": 0.4735,
"xmax": 0.23668,
"ymax": 0.51779
}
},
{
"page": 1,
"range": {
"start": 316,
"end": 324
},
"box": {
"xmin": 0.06795,
"ymin": 0.58768,
"xmax": 0.17743,
"ymax": 0.64151
}
},
{
"page": 1,
"range": {
"start": 324,
"end": 395
},
"box": {
"xmin": 0.0668,
"ymin": 0.64606,
"xmax": 0.25142,
"ymax": 0.68814
}
}
],
"markdown": null,
"children": null,
"row": null,
"col": null,
"colspan": null,
"rowspan": null
},
{
"type": "text",
"id": "text-2",
"span": null,
"grounding": {
"page": 1,
"range": {
"start": 397,
"end": 551
},
"box": {
"xmin": 0.34985,
"ymin": 0.25232,
"xmax": 0.64645,
"ymax": 0.72886
}
},
"atomic_grounding": [
{
"page": 1,
"range": {
"start": 397,
"end": 417
},
"box": {
"xmin": 0.35505,
"ymin": 0.263,
"xmax": 0.55795,
"ymax": 0.29432
}
},
{
"page": 1,
"range": {
"start": 417,
"end": 443
},
"box": {
"xmin": 0.35547,
"ymin": 0.3013,
"xmax": 0.54392,
"ymax": 0.32811
}
},
{
"page": 1,
"range": {
"start": 443,
"end": 474
},
"box": {
"xmin": 0.35527,
"ymin": 0.32817,
"xmax": 0.58207,
"ymax": 0.35481
}
},
{
"page": 1,
"range": {
"start": 474,
"end": 482
},
"box": {
"xmin": 0.37667,
"ymin": 0.416,
"xmax": 0.48655,
"ymax": 0.47044
}
},
{
"page": 1,
"range": {
"start": 482,
"end": 515
},
"box": {
"xmin": 0.37537,
"ymin": 0.4734,
"xmax": 0.50181,
"ymax": 0.49557
}
},
{
"page": 1,
"range": {
"start": 515,
"end": 520
},
"box": {
"xmin": 0.37627,
"ymin": 0.59164,
"xmax": 0.42623,
"ymax": 0.63802
}
},
{
"page": 1,
"range": {
"start": 520,
"end": 551
},
"box": {
"xmin": 0.37463,
"ymin": 0.64594,
"xmax": 0.56461,
"ymax": 0.66821
}
}
],
"markdown": null,
"children": null,
"row": null,
"col": null,
"colspan": null,
"rowspan": null
},
{
"type": "text",
"id": "text-3",
"span": null,
"grounding": {
"page": 1,
"range": {
"start": 553,
"end": 751
},
"box": {
"xmin": 0.65831,
"ymin": 0.25328,
"xmax": 0.95425,
"ymax": 0.72691
}
},
"atomic_grounding": [
{
"page": 1,
"range": {
"start": 553,
"end": 575
},
"box": {
"xmin": 0.66342,
"ymin": 0.26239,
"xmax": 0.8702,
"ymax": 0.29196
}
},
{
"page": 1,
"range": {
"start": 575,
"end": 600
},
"box": {
"xmin": 0.66376,
"ymin": 0.30104,
"xmax": 0.85329,
"ymax": 0.32817
}
},
{
"page": 1,
"range": {
"start": 600,
"end": 624
},
"box": {
"xmin": 0.66401,
"ymin": 0.32845,
"xmax": 0.84281,
"ymax": 0.35423
}
},
{
"page": 1,
"range": {
"start": 624,
"end": 629
},
"box": {
"xmin": 0.68407,
"ymin": 0.41873,
"xmax": 0.76237,
"ymax": 0.46689
}
},
{
"page": 1,
"range": {
"start": 629,
"end": 672
},
"box": {
"xmin": 0.68309,
"ymin": 0.47349,
"xmax": 0.87044,
"ymax": 0.49679
}
},
{
"page": 1,
"range": {
"start": 672,
"end": 678
},
"box": {
"xmin": 0.6852,
"ymin": 0.59073,
"xmax": 0.78294,
"ymax": 0.63814
}
},
{
"page": 1,
"range": {
"start": 678,
"end": 707
},
"box": {
"xmin": 0.6834,
"ymin": 0.64518,
"xmax": 0.86301,
"ymax": 0.66705
}
},
{
"page": 1,
"range": {
"start": 707,
"end": 751
},
"box": {
"xmin": 0.68364,
"ymin": 0.6673,
"xmax": 0.87665,
"ymax": 0.68787
}
}
],
"markdown": null,
"children": null,
"row": null,
"col": null,
"colspan": null,
"rowspan": null
},
{
"type": "text",
"id": "text-4",
"span": null,
"grounding": {
"page": 1,
"range": {
"start": 753,
"end": 1705
},
"box": {
"xmin": 0.04303,
"ymin": 0.82218,
"xmax": 0.95349,
"ymax": 0.92378
}
},
"atomic_grounding": [
{
"page": 1,
"range": {
"start": 753,
"end": 957
},
"box": {
"xmin": 0.04691,
"ymin": 0.82988,
"xmax": 0.94863,
"ymax": 0.8456
}
},
{
"page": 1,
"range": {
"start": 957,
"end": 1162
},
"box": {
"xmin": 0.04655,
"ymin": 0.8459,
"xmax": 0.94801,
"ymax": 0.86131
}
},
{
"page": 1,
"range": {
"start": 1162,
"end": 1362
},
"box": {
"xmin": 0.04667,
"ymin": 0.86121,
"xmax": 0.92454,
"ymax": 0.87623
}
},
{
"page": 1,
"range": {
"start": 1362,
"end": 1564
},
"box": {
"xmin": 0.04652,
"ymin": 0.87641,
"xmax": 0.93992,
"ymax": 0.8914
}
},
{
"page": 1,
"range": {
"start": 1564,
"end": 1627
},
"box": {
"xmin": 0.04734,
"ymin": 0.89122,
"xmax": 0.33209,
"ymax": 0.90618
}
},
{
"page": 1,
"range": {
"start": 1627,
"end": 1705
},
"box": {
"xmin": 0.04793,
"ymin": 0.90635,
"xmax": 0.39838,
"ymax": 0.92227
}
}
],
"markdown": null,
"children": null,
"row": null,
"col": null,
"colspan": null,
"rowspan": null
},
{
"type": "marginalia",
"id": "marginalia-0",
"span": null,
"grounding": {
"page": 1,
"range": {
"start": 1707,
"end": 1739
},
"box": {
"xmin": 0.04563,
"ymin": 0.92536,
"xmax": 0.2191,
"ymax": 0.94813
}
},
"atomic_grounding": [
{
"page": 1,
"range": {
"start": 1707,
"end": 1739
},
"box": {
"xmin": 0.04858,
"ymin": 0.9278,
"xmax": 0.21425,
"ymax": 0.94431
}
}
],
"markdown": null,
"children": null,
"row": null,
"col": null,
"colspan": null,
"rowspan": null
},
{
"type": "marginalia",
"id": "marginalia-1",
"span": null,
"grounding": {
"page": 1,
"range": {
"start": 1741,
"end": 1756
},
"box": {
"xmin": 0.85435,
"ymin": 0.92168,
"xmax": 0.95479,
"ymax": 0.94612
}
},
"atomic_grounding": [
{
"page": 1,
"range": {
"start": 1741,
"end": 1756
},
"box": {
"xmin": 0.85906,
"ymin": 0.92626,
"xmax": 0.94956,
"ymax": 0.9408
}
}
],
"markdown": null,
"children": null,
"row": null,
"col": null,
"colspan": null,
"rowspan": null
}
]
}
]
},
"grounding": null,
"metadata": {
"req_id": null,
"job_id": "parse-01m3d4hw0dve7qxhp5bzrmfve6",
"model_version": "dpt-3-pro-20260710",
"page_count": 1,
"markdown_chars": null,
"output_markdown_chars": 1805,
"range_units": "unicode_codepoints",
"openapi_spec": "https://api.ade.landing.ai/openapi.json",
"failed_pages": [],
"duration_ms": 6653,
"billing": {
"service_tier": "standard",
"total_credits": 1.0
}
}
}